C6H11O11P2+ — CID 57110164
(3,4-dicarboxy-3-phosphonobutanoyl)-trihydroxyphosphanium (PubChem CID 57110164) has the molecular formula C6H11O11P2+ and a molecular weight of 321.09 g/mol. Its IUPAC name is (3,4-dicarboxy-3-phosphonobutanoyl)-trihydroxyphosphanium.
| Compound Name | (3,4-dicarboxy-3-phosphonobutanoyl)-trihydroxyphosphanium |
|---|---|
| PubChem CID | 57110164 |
| Molecular Formula | C6H11O11P2+ |
| Molecular Weight | 321.09 g/mol |
| Exact Mass | 320.98 |
| IUPAC Name | (3,4-dicarboxy-3-phosphonobutanoyl)-trihydroxyphosphanium |
| SMILES | O=C(O)CC(CC(=O)[P+](O)(O)O)(C(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C6H10O11P2/c7-3(8)1-6(5(10)11,19(15,16)17)2-4(9)18(12,13)14/h12-14H,1-2H2,(H3-,7,8,10,11,15,16,17)/p+1 |
| InChIKey | MMNCGBNOPAQNCX-UHFFFAOYSA-O |
| XLogP | -1.88 |
| TPSA | 209.89 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.09 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|