C12H16O9P2 — CID 88765115
2-[2-[hydroxy(phenyl)phosphoryl]ethyl]-2-phosphonobutanedioic acid (PubChem CID 88765115) has the molecular formula C12H16O9P2 and a molecular weight of 366.20 g/mol. Its IUPAC name is 2-[2-[hydroxy(phenyl)phosphoryl]ethyl]-2-phosphonobutanedioic acid.
| Compound Name | 2-[2-[hydroxy(phenyl)phosphoryl]ethyl]-2-phosphonobutanedioic acid |
|---|---|
| PubChem CID | 88765115 |
| Molecular Formula | C12H16O9P2 |
| Molecular Weight | 366.20 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 2-[2-[hydroxy(phenyl)phosphoryl]ethyl]-2-phosphonobutanedioic acid |
| SMILES | O=C(O)CC(CCP(=O)(O)c1ccccc1)(C(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C12H16O9P2/c13-10(14)8-12(11(15)16,23(19,20)21)6-7-22(17,18)9-4-2-1-3-5-9/h1-5H,6-8H2,(H,13,14)(H,15,16)(H,17,18)(H2,19,20,21) |
| InChIKey | WGSGCSLCWQVKIH-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 169.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.20 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|