C7H14O9P2 — CID 88765234
2-[2-[hydroxy(methyl)phosphoryl]ethyl]-2-phosphonobutanedioic acid (PubChem CID 88765234) has the molecular formula C7H14O9P2 and a molecular weight of 304.13 g/mol. Its IUPAC name is 2-[2-[hydroxy(methyl)phosphoryl]ethyl]-2-phosphonobutanedioic acid.
| Compound Name | 2-[2-[hydroxy(methyl)phosphoryl]ethyl]-2-phosphonobutanedioic acid |
|---|---|
| PubChem CID | 88765234 |
| Molecular Formula | C7H14O9P2 |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 2-[2-[hydroxy(methyl)phosphoryl]ethyl]-2-phosphonobutanedioic acid |
| SMILES | CP(=O)(O)CCC(CC(=O)O)(C(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C7H14O9P2/c1-17(12,13)3-2-7(6(10)11,4-5(8)9)18(14,15)16/h2-4H2,1H3,(H,8,9)(H,10,11)(H,12,13)(H2,14,15,16) |
| InChIKey | PMNRWFYGJGIJHC-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 169.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|