C7H14O10P2 — CID 21245624
2-(1,1-diphosphonoethyl)-2-methylbutanedioic acid (PubChem CID 21245624) has the molecular formula C7H14O10P2 and a molecular weight of 320.13 g/mol. Its IUPAC name is 2-(1,1-diphosphonoethyl)-2-methylbutanedioic acid.
| Compound Name | 2-(1,1-diphosphonoethyl)-2-methylbutanedioic acid |
|---|---|
| PubChem CID | 21245624 |
| Molecular Formula | C7H14O10P2 |
| Molecular Weight | 320.13 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | 2-(1,1-diphosphonoethyl)-2-methylbutanedioic acid |
| SMILES | CC(CC(=O)O)(C(=O)O)C(C)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C7H14O10P2/c1-6(5(10)11,3-4(8)9)7(2,18(12,13)14)19(15,16)17/h3H2,1-2H3,(H,8,9)(H,10,11)(H2,12,13,14)(H2,15,16,17) |
| InChIKey | NUZPBDSCFJGAEJ-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 189.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.13 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|