C8H16O11P2 — CID 21464979
2-(2-hydroxypropyl)-2,4-diphosphonopentanedioic acid (PubChem CID 21464979) has the molecular formula C8H16O11P2 and a molecular weight of 350.15 g/mol. Its IUPAC name is 2-(2-hydroxypropyl)-2,4-diphosphonopentanedioic acid.
| Compound Name | 2-(2-hydroxypropyl)-2,4-diphosphonopentanedioic acid |
|---|---|
| PubChem CID | 21464979 |
| Molecular Formula | C8H16O11P2 |
| Molecular Weight | 350.15 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 2-(2-hydroxypropyl)-2,4-diphosphonopentanedioic acid |
| SMILES | CC(O)CC(CC(C(=O)O)P(=O)(O)O)(C(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C8H16O11P2/c1-4(9)2-8(7(12)13,21(17,18)19)3-5(6(10)11)20(14,15)16/h4-5,9H,2-3H2,1H3,(H,10,11)(H,12,13)(H2,14,15,16)(H2,17,18,19) |
| InChIKey | JJZFLLAZNZLYLA-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 209.89 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.15 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|