C4H9O9P2+ — CID 57318590
(3-carboxy-3-phosphonopropanoyl)-trihydroxyphosphanium (PubChem CID 57318590) has the molecular formula C4H9O9P2+ and a molecular weight of 263.06 g/mol. Its IUPAC name is (3-carboxy-3-phosphonopropanoyl)-trihydroxyphosphanium.
| Compound Name | (3-carboxy-3-phosphonopropanoyl)-trihydroxyphosphanium |
|---|---|
| PubChem CID | 57318590 |
| Molecular Formula | C4H9O9P2+ |
| Molecular Weight | 263.06 g/mol |
| Exact Mass | 262.97 |
| IUPAC Name | (3-carboxy-3-phosphonopropanoyl)-trihydroxyphosphanium |
| SMILES | O=C(O)C(CC(=O)[P+](O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C4H8O9P2/c5-3(15(11,12)13)1-2(4(6)7)14(8,9)10/h2,11-13H,1H2,(H2-,6,7,8,9,10)/p+1 |
| InChIKey | VZZAIBULLUGVSE-UHFFFAOYSA-O |
| XLogP | -1.73 |
| TPSA | 172.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.06 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|