C5H14NO7P2+ — CID 57287731
(5-amino-5-phosphonopentanoyl)-trihydroxyphosphanium (PubChem CID 57287731) has the molecular formula C5H14NO7P2+ and a molecular weight of 262.11 g/mol. Its IUPAC name is (5-amino-5-phosphonopentanoyl)-trihydroxyphosphanium.
| Compound Name | (5-amino-5-phosphonopentanoyl)-trihydroxyphosphanium |
|---|---|
| PubChem CID | 57287731 |
| Molecular Formula | C5H14NO7P2+ |
| Molecular Weight | 262.11 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | (5-amino-5-phosphonopentanoyl)-trihydroxyphosphanium |
| SMILES | NC(CCCC(=O)[P+](O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C5H13NO7P2/c6-4(14(8,9)10)2-1-3-5(7)15(11,12)13/h4,11-13H,1-3,6H2,(H-,8,9,10)/p+1 |
| InChIKey | ZHQGIALTRNBOSY-UHFFFAOYSA-O |
| XLogP | -1.11 |
| TPSA | 161.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.11 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|