C5H14NO4P — CID 15348708
[(1S)-1-amino-3-hydroxypentyl]phosphonic acid (PubChem CID 15348708) has the molecular formula C5H14NO4P and a molecular weight of 183.14 g/mol. Its IUPAC name is [(1S)-1-amino-3-hydroxypentyl]phosphonic acid.
| Compound Name | [(1S)-1-amino-3-hydroxypentyl]phosphonic acid |
|---|---|
| PubChem CID | 15348708 |
| Molecular Formula | C5H14NO4P |
| Molecular Weight | 183.14 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | [(1S)-1-amino-3-hydroxypentyl]phosphonic acid |
| SMILES | CCC(O)C[C@@H](N)P(=O)(O)O |
| InChI | InChI=1S/C5H14NO4P/c1-2-4(7)3-5(6)11(8,9)10/h4-5,7H,2-3,6H2,1H3,(H2,8,9,10)/t4?,5-/m0/s1 |
| InChIKey | WXGVIJFCHHQEGO-AKGZTFGVSA-N |
| XLogP | -0.39 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.14 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|