C5H15N4O3P — CID 71563402
[(1R)-1-amino-4-(diaminomethylideneamino)butyl]phosphonic acid (PubChem CID 71563402) has the molecular formula C5H15N4O3P and a molecular weight of 210.17 g/mol. Its IUPAC name is [(1R)-1-amino-4-(diaminomethylideneamino)butyl]phosphonic acid.
| Compound Name | [(1R)-1-amino-4-(diaminomethylideneamino)butyl]phosphonic acid |
|---|---|
| PubChem CID | 71563402 |
| Molecular Formula | C5H15N4O3P |
| Molecular Weight | 210.17 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | [(1R)-1-amino-4-(diaminomethylideneamino)butyl]phosphonic acid |
| SMILES | NC(N)=NCCC[C@H](N)P(=O)(O)O |
| InChI | InChI=1S/C5H15N4O3P/c6-4(13(10,11)12)2-1-3-9-5(7)8/h4H,1-3,6H2,(H4,7,8,9)(H2,10,11,12)/t4-/m1/s1 |
| InChIKey | MMEPWCMDQUSOLC-SCSAIBSYSA-N |
| XLogP | -1.50 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.17 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|