C8H22N5O6P — CID 138397398
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-aminoethyl dihydrogen phosphate (PubChem CID 138397398) has the molecular formula C8H22N5O6P and a molecular weight of 315.27 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-aminoethyl dihydrogen phosphate.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-aminoethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 138397398 |
| Molecular Formula | C8H22N5O6P |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-aminoethyl dihydrogen phosphate |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)O.NCCOP(=O)(O)O |
| InChI | InChI=1S/C6H14N4O2.C2H8NO4P/c7-4(5(11)12)2-1-3-10-6(8)9;3-1-2-7-8(4,5)6/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);1-3H2,(H2,4,5,6)/t4-;/m0./s1 |
| InChIKey | KPUSLFZICUAWHG-WCCKRBBISA-N |
| XLogP | -2.49 |
| TPSA | 220.50 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|