C5H13N4OP — CID 89493357
2-(4-amino-4-phosphorosobutyl)guanidine (PubChem CID 89493357) has the molecular formula C5H13N4OP and a molecular weight of 176.16 g/mol. Its IUPAC name is 2-(4-amino-4-phosphorosobutyl)guanidine.
| Compound Name | 2-(4-amino-4-phosphorosobutyl)guanidine |
|---|---|
| PubChem CID | 89493357 |
| Molecular Formula | C5H13N4OP |
| Molecular Weight | 176.16 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 2-(4-amino-4-phosphorosobutyl)guanidine |
| SMILES | NC(N)=NCCCC(N)P=O |
| InChI | InChI=1S/C5H13N4OP/c6-4(11-10)2-1-3-9-5(7)8/h4H,1-3,6H2,(H4,7,8,9) |
| InChIKey | QPEQFIMZPNYSRV-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.16 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|