C8H11O10P — CID 18519476
2-[1,2-dicarboxyethyl(hydroxy)phosphoryl]butanedioic acid (PubChem CID 18519476) has the molecular formula C8H11O10P and a molecular weight of 298.14 g/mol. Its IUPAC name is 2-[1,2-dicarboxyethyl(hydroxy)phosphoryl]butanedioic acid.
| Compound Name | 2-[1,2-dicarboxyethyl(hydroxy)phosphoryl]butanedioic acid |
|---|---|
| PubChem CID | 18519476 |
| Molecular Formula | C8H11O10P |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 2-[1,2-dicarboxyethyl(hydroxy)phosphoryl]butanedioic acid |
| SMILES | O=C(O)CC(C(=O)O)P(=O)(O)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H11O10P/c9-5(10)1-3(7(13)14)19(17,18)4(8(15)16)2-6(11)12/h3-4H,1-2H2,(H,9,10)(H,11,12)(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | LNHZPPSPJRNZJO-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 186.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|