C7H12NaO9P — CID 175304454
sodium;hydride;4-phosphonobutane-1,2,4-tricarboxylic acid (PubChem CID 175304454) has the molecular formula C7H12NaO9P and a molecular weight of 294.13 g/mol. Its IUPAC name is sodium;hydride;4-phosphonobutane-1,2,4-tricarboxylic acid.
| Compound Name | sodium;hydride;4-phosphonobutane-1,2,4-tricarboxylic acid |
|---|---|
| PubChem CID | 175304454 |
| Molecular Formula | C7H12NaO9P |
| Molecular Weight | 294.13 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | sodium;hydride;4-phosphonobutane-1,2,4-tricarboxylic acid |
| SMILES | O=C(O)CC(CC(C(=O)O)P(=O)(O)O)C(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C7H11O9P.Na.H/c8-5(9)2-3(6(10)11)1-4(7(12)13)17(14,15)16;;/h3-4H,1-2H2,(H,8,9)(H,10,11)(H,12,13)(H2,14,15,16);;/q;+1;-1 |
| InChIKey | NDJCJFMGGXWIFP-UHFFFAOYSA-N |
| XLogP | -3.70 |
| TPSA | 169.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.13 |
| LogP ≤ 5 | -3.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|