trisodium;hydride;propane-1,2,3-tricarboxylic acid

C6H11Na3O6 — CID 173014092

IUPACtrisodium;hydride;propane-1,2,3-tricarboxylic acid
SMILESO=C(O)CC(CC(=O)O)C(=O)O.[H-].[H-].[H-].[Na+].[Na+].[Na+]
InChIInChI=1S/C6H8O6.3Na.3H/c7-4(8)1-3(6(11)12)2-5(9)10;;;;;;/h3H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;;;;;/q;3*+1;3*-1
InChIKeyZGAYBGRUKYYTMA-UHFFFAOYSA-N
MW248.12 g/mol
LogP-9.01
Rot. Bonds5

About trisodium;hydride;propane-1,2,3-tricarboxylic acid

trisodium;hydride;propane-1,2,3-tricarboxylic acid (PubChem CID 173014092) has the molecular formula C6H11Na3O6 and a molecular weight of 248.12 g/mol. Its IUPAC name is trisodium;hydride;propane-1,2,3-tricarboxylic acid.

Molecular Properties

Compound Nametrisodium;hydride;propane-1,2,3-tricarboxylic acid
PubChem CID173014092
Molecular FormulaC6H11Na3O6
Molecular Weight248.12 g/mol
Exact Mass248.02
IUPAC Nametrisodium;hydride;propane-1,2,3-tricarboxylic acid
SMILESO=C(O)CC(CC(=O)O)C(=O)O.[H-].[H-].[H-].[Na+].[Na+].[Na+]
InChIInChI=1S/C6H8O6.3Na.3H/c7-4(8)1-3(6(11)12)2-5(9)10;;;;;;/h3H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;;;;;/q;3*+1;3*-1
InChIKeyZGAYBGRUKYYTMA-UHFFFAOYSA-N
XLogP-9.01
TPSA111.90 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.12
LogP ≤ 5-9.01
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze trisodium;hydride;propane-1,2,3-tricarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of trisodium;hydride;propane-1,2,3-tricarboxylic acid?
The IUPAC name of trisodium;hydride;propane-1,2,3-tricarboxylic acid (CID 173014092) is trisodium;hydride;propane-1,2,3-tricarboxylic acid.
What is the SMILES notation for trisodium;hydride;propane-1,2,3-tricarboxylic acid?
The canonical SMILES for trisodium;hydride;propane-1,2,3-tricarboxylic acid is O=C(O)CC(CC(=O)O)C(=O)O.[H-].[H-].[H-].[Na+].[Na+].[Na+].
What is the InChIKey of trisodium;hydride;propane-1,2,3-tricarboxylic acid?
The InChIKey is ZGAYBGRUKYYTMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O6.3Na.3H/c7-4(8)1-3(6(11)12)2-5(9)10;;;;;;/h3H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;;;;;/q;3*+1;3*-1.
What are the key properties of trisodium;hydride;propane-1,2,3-tricarboxylic acid?
trisodium;hydride;propane-1,2,3-tricarboxylic acid has a molecular weight of 248.12 g/mol, XLogP of -9.01, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trisodium;hydride;propane-1,2,3-tricarboxylic acid is sourced from PubChem (CID 173014092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).