C6H11Na3O6 — CID 173014092
trisodium;hydride;propane-1,2,3-tricarboxylic acid (PubChem CID 173014092) has the molecular formula C6H11Na3O6 and a molecular weight of 248.12 g/mol. Its IUPAC name is trisodium;hydride;propane-1,2,3-tricarboxylic acid.
| Compound Name | trisodium;hydride;propane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 173014092 |
| Molecular Formula | C6H11Na3O6 |
| Molecular Weight | 248.12 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | trisodium;hydride;propane-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)CC(CC(=O)O)C(=O)O.[H-].[H-].[H-].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C6H8O6.3Na.3H/c7-4(8)1-3(6(11)12)2-5(9)10;;;;;;/h3H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;;;;;/q;3*+1;3*-1 |
| InChIKey | ZGAYBGRUKYYTMA-UHFFFAOYSA-N |
| XLogP | -9.01 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.12 |
| LogP ≤ 5 | -9.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |