C11H17NO10 — CID 88608659
2-aminopentanedioic acid;propane-1,2,3-tricarboxylic acid (PubChem CID 88608659) has the molecular formula C11H17NO10 and a molecular weight of 323.25 g/mol. Its IUPAC name is 2-aminopentanedioic acid;propane-1,2,3-tricarboxylic acid.
| Compound Name | 2-aminopentanedioic acid;propane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 88608659 |
| Molecular Formula | C11H17NO10 |
| Molecular Weight | 323.25 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 2-aminopentanedioic acid;propane-1,2,3-tricarboxylic acid |
| SMILES | NC(CCC(=O)O)C(=O)O.O=C(O)CC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H8O6.C5H9NO4/c7-4(8)1-3(6(11)12)2-5(9)10;6-3(5(9)10)1-2-4(7)8/h3H,1-2H2,(H,7,8)(H,9,10)(H,11,12);3H,1-2,6H2,(H,7,8)(H,9,10) |
| InChIKey | WCVXBYNRKXHHTL-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 212.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.25 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |