About (2S)-2-propylbutanedioic acid
(2S)-2-propylbutanedioic acid (PubChem CID 12648185) has the molecular formula C7H12O4
and a molecular weight of 160.17 g/mol. Its IUPAC name is (2S)-2-propylbutanedioic acid.
Molecular Properties
| Compound Name | (2S)-2-propylbutanedioic acid |
| PubChem CID | 12648185 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | (2S)-2-propylbutanedioic acid |
| SMILES | CCC[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H12O4/c1-2-3-5(7(10)11)4-6(8)9/h5H,2-4H2,1H3,(H,8,9)(H,10,11)/t5-/m0/s1 |
| InChIKey | QLTZBYGZXPKHLF-YFKPBYRVSA-N |
| XLogP | 0.96 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-propylbutanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-propylbutanedioic acid?
The IUPAC name of (2S)-2-propylbutanedioic acid (CID 12648185) is (2S)-2-propylbutanedioic acid.
What is the SMILES notation for (2S)-2-propylbutanedioic acid?
The canonical SMILES for (2S)-2-propylbutanedioic acid is CCC[C@@H](CC(=O)O)C(=O)O.
What is the InChIKey of (2S)-2-propylbutanedioic acid?
The InChIKey is QLTZBYGZXPKHLF-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H12O4/c1-2-3-5(7(10)11)4-6(8)9/h5H,2-4H2,1H3,(H,8,9)(H,10,11)/t5-/m0/s1.
What are the key properties of (2S)-2-propylbutanedioic acid?
(2S)-2-propylbutanedioic acid has a molecular weight of 160.17 g/mol, XLogP of 0.96, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-propylbutanedioic acid is sourced from PubChem (CID 12648185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).