C9H14O6 — CID 14251275
hexane-1,2,5-tricarboxylic acid (PubChem CID 14251275) has the molecular formula C9H14O6 and a molecular weight of 218.20 g/mol. Its IUPAC name is hexane-1,2,5-tricarboxylic acid.
| Compound Name | hexane-1,2,5-tricarboxylic acid |
|---|---|
| PubChem CID | 14251275 |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | hexane-1,2,5-tricarboxylic acid |
| SMILES | CC(CCC(CC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C9H14O6/c1-5(8(12)13)2-3-6(9(14)15)4-7(10)11/h5-6H,2-4H2,1H3,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | GWCHPNKHMFKKIQ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |