2-methylpentanedioic acid;3-methylpentanedioic acid

C12H20O8 — CID 159942344

IUPAC2-methylpentanedioic acid;3-methylpentanedioic acid
SMILESCC(CC(=O)O)CC(=O)O.CC(CCC(=O)O)C(=O)O
InChIInChI=1S/2C6H10O4/c1-4(2-5(7)8)3-6(9)10;1-4(6(9)10)2-3-5(7)8/h2*4H,2-3H2,1H3,(H,7,8)(H,9,10)
InChIKeyOBARRIWZELWESC-UHFFFAOYSA-N
MW292.28 g/mol
LogP1.14
Rot. Bonds8

About 2-methylpentanedioic acid;3-methylpentanedioic acid

2-methylpentanedioic acid;3-methylpentanedioic acid (PubChem CID 159942344) has the molecular formula C12H20O8 and a molecular weight of 292.28 g/mol. Its IUPAC name is 2-methylpentanedioic acid;3-methylpentanedioic acid.

Molecular Properties

Compound Name2-methylpentanedioic acid;3-methylpentanedioic acid
PubChem CID159942344
Molecular FormulaC12H20O8
Molecular Weight292.28 g/mol
Exact Mass292.12
IUPAC Name2-methylpentanedioic acid;3-methylpentanedioic acid
SMILESCC(CC(=O)O)CC(=O)O.CC(CCC(=O)O)C(=O)O
InChIInChI=1S/2C6H10O4/c1-4(2-5(7)8)3-6(9)10;1-4(6(9)10)2-3-5(7)8/h2*4H,2-3H2,1H3,(H,7,8)(H,9,10)
InChIKeyOBARRIWZELWESC-UHFFFAOYSA-N
XLogP1.14
TPSA149.20 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.28
LogP ≤ 51.14
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 2-methylpentanedioic acid;3-methylpentanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methylpentanedioic acid;3-methylpentanedioic acid?
The IUPAC name of 2-methylpentanedioic acid;3-methylpentanedioic acid (CID 159942344) is 2-methylpentanedioic acid;3-methylpentanedioic acid.
What is the SMILES notation for 2-methylpentanedioic acid;3-methylpentanedioic acid?
The canonical SMILES for 2-methylpentanedioic acid;3-methylpentanedioic acid is CC(CC(=O)O)CC(=O)O.CC(CCC(=O)O)C(=O)O.
What is the InChIKey of 2-methylpentanedioic acid;3-methylpentanedioic acid?
The InChIKey is OBARRIWZELWESC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H10O4/c1-4(2-5(7)8)3-6(9)10;1-4(6(9)10)2-3-5(7)8/h2*4H,2-3H2,1H3,(H,7,8)(H,9,10).
What are the key properties of 2-methylpentanedioic acid;3-methylpentanedioic acid?
2-methylpentanedioic acid;3-methylpentanedioic acid has a molecular weight of 292.28 g/mol, XLogP of 1.14, 8 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentanedioic acid;3-methylpentanedioic acid is sourced from PubChem (CID 159942344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).