About 2-methylpentanedioic acid;3-methylpentanedioic acid
2-methylpentanedioic acid;3-methylpentanedioic acid (PubChem CID 159942344) has the molecular formula C12H20O8
and a molecular weight of 292.28 g/mol. Its IUPAC name is 2-methylpentanedioic acid;3-methylpentanedioic acid.
Molecular Properties
| Compound Name | 2-methylpentanedioic acid;3-methylpentanedioic acid |
| PubChem CID | 159942344 |
| Molecular Formula | C12H20O8 |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-methylpentanedioic acid;3-methylpentanedioic acid |
| SMILES | CC(CC(=O)O)CC(=O)O.CC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/2C6H10O4/c1-4(2-5(7)8)3-6(9)10;1-4(6(9)10)2-3-5(7)8/h2*4H,2-3H2,1H3,(H,7,8)(H,9,10) |
| InChIKey | OBARRIWZELWESC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylpentanedioic acid;3-methylpentanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentanedioic acid;3-methylpentanedioic acid?
The IUPAC name of 2-methylpentanedioic acid;3-methylpentanedioic acid (CID 159942344) is 2-methylpentanedioic acid;3-methylpentanedioic acid.
What is the SMILES notation for 2-methylpentanedioic acid;3-methylpentanedioic acid?
The canonical SMILES for 2-methylpentanedioic acid;3-methylpentanedioic acid is CC(CC(=O)O)CC(=O)O.CC(CCC(=O)O)C(=O)O.
What is the InChIKey of 2-methylpentanedioic acid;3-methylpentanedioic acid?
The InChIKey is OBARRIWZELWESC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H10O4/c1-4(2-5(7)8)3-6(9)10;1-4(6(9)10)2-3-5(7)8/h2*4H,2-3H2,1H3,(H,7,8)(H,9,10).
What are the key properties of 2-methylpentanedioic acid;3-methylpentanedioic acid?
2-methylpentanedioic acid;3-methylpentanedioic acid has a molecular weight of 292.28 g/mol, XLogP of 1.14, 8 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentanedioic acid;3-methylpentanedioic acid is sourced from PubChem (CID 159942344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).