C16H26O10 — CID 118196670
2-methylbutanedioic acid;2-methylbut-3-enoic acid;2-methylpentanedioic acid (PubChem CID 118196670) has the molecular formula C16H26O10 and a molecular weight of 378.37 g/mol. Its IUPAC name is 2-methylbutanedioic acid;2-methylbut-3-enoic acid;2-methylpentanedioic acid.
| Compound Name | 2-methylbutanedioic acid;2-methylbut-3-enoic acid;2-methylpentanedioic acid |
|---|---|
| PubChem CID | 118196670 |
| Molecular Formula | C16H26O10 |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 2-methylbutanedioic acid;2-methylbut-3-enoic acid;2-methylpentanedioic acid |
| SMILES | C=CC(C)C(=O)O.CC(CC(=O)O)C(=O)O.CC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H10O4.C5H8O4.C5H8O2/c1-4(6(9)10)2-3-5(7)8;1-3(5(8)9)2-4(6)7;1-3-4(2)5(6)7/h4H,2-3H2,1H3,(H,7,8)(H,9,10);3H,2H2,1H3,(H,6,7)(H,8,9);3-4H,1H2,2H3,(H,6,7) |
| InChIKey | PICILRMDIKAARJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 186.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|