C6H13NO10P2 — CID 90023765
3-[(2-carboxy-1-phosphonoethyl)amino]-3-phosphonopropanoic acid (PubChem CID 90023765) has the molecular formula C6H13NO10P2 and a molecular weight of 321.12 g/mol. Its IUPAC name is 3-[(2-carboxy-1-phosphonoethyl)amino]-3-phosphonopropanoic acid.
| Compound Name | 3-[(2-carboxy-1-phosphonoethyl)amino]-3-phosphonopropanoic acid |
|---|---|
| PubChem CID | 90023765 |
| Molecular Formula | C6H13NO10P2 |
| Molecular Weight | 321.12 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | 3-[(2-carboxy-1-phosphonoethyl)amino]-3-phosphonopropanoic acid |
| SMILES | O=C(O)CC(NC(CC(=O)O)P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C6H13NO10P2/c8-5(9)1-3(18(12,13)14)7-4(2-6(10)11)19(15,16)17/h3-4,7H,1-2H2,(H,8,9)(H,10,11)(H2,12,13,14)(H2,15,16,17) |
| InChIKey | WZDKLGLVVNCTLM-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 201.69 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.12 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|