C10H22N3O5P — CID 151888138
[(4S)-4-amino-1-[[(2S)-2-aminopropanoyl]amino]-3-oxoheptyl]phosphonic acid (PubChem CID 151888138) has the molecular formula C10H22N3O5P and a molecular weight of 295.28 g/mol. Its IUPAC name is [(4S)-4-amino-1-[[(2S)-2-aminopropanoyl]amino]-3-oxoheptyl]phosphonic acid.
| Compound Name | [(4S)-4-amino-1-[[(2S)-2-aminopropanoyl]amino]-3-oxoheptyl]phosphonic acid |
|---|---|
| PubChem CID | 151888138 |
| Molecular Formula | C10H22N3O5P |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | [(4S)-4-amino-1-[[(2S)-2-aminopropanoyl]amino]-3-oxoheptyl]phosphonic acid |
| SMILES | CCC[C@H](N)C(=O)CC(NC(=O)[C@H](C)N)P(=O)(O)O |
| InChI | InChI=1S/C10H22N3O5P/c1-3-4-7(12)8(14)5-9(19(16,17)18)13-10(15)6(2)11/h6-7,9H,3-5,11-12H2,1-2H3,(H,13,15)(H2,16,17,18)/t6-,7-,9?/m0/s1 |
| InChIKey | SQDSDZVYQRWWCT-ASLNEKEESA-N |
| XLogP | -0.96 |
| TPSA | 155.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|