C5H10F3N2O4P — CID 85321325
[1-(2-aminopropanoylamino)-2,2,2-trifluoroethyl]phosphonic acid (PubChem CID 85321325) has the molecular formula C5H10F3N2O4P and a molecular weight of 250.11 g/mol. Its IUPAC name is [1-(2-aminopropanoylamino)-2,2,2-trifluoroethyl]phosphonic acid.
| Compound Name | [1-(2-aminopropanoylamino)-2,2,2-trifluoroethyl]phosphonic acid |
|---|---|
| PubChem CID | 85321325 |
| Molecular Formula | C5H10F3N2O4P |
| Molecular Weight | 250.11 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | [1-(2-aminopropanoylamino)-2,2,2-trifluoroethyl]phosphonic acid |
| SMILES | CC(N)C(=O)NC(C(F)(F)F)P(=O)(O)O |
| InChI | InChI=1S/C5H10F3N2O4P/c1-2(9)3(11)10-4(5(6,7)8)15(12,13)14/h2,4H,9H2,1H3,(H,10,11)(H2,12,13,14) |
| InChIKey | SQXAVRYQKVUBGV-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.11 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|