C8H18N3O5P — CID 54524014
[(1R)-1-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]ethyl]phosphonic acid (PubChem CID 54524014) has the molecular formula C8H18N3O5P and a molecular weight of 267.22 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]ethyl]phosphonic acid.
| Compound Name | [(1R)-1-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]ethyl]phosphonic acid |
|---|---|
| PubChem CID | 54524014 |
| Molecular Formula | C8H18N3O5P |
| Molecular Weight | 267.22 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | [(1R)-1-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]ethyl]phosphonic acid |
| SMILES | C[C@H](N)C(=O)N[C@@H](C)C(=O)N[C@@H](C)P(=O)(O)O |
| InChI | InChI=1S/C8H18N3O5P/c1-4(9)7(12)10-5(2)8(13)11-6(3)17(14,15)16/h4-6H,9H2,1-3H3,(H,10,12)(H,11,13)(H2,14,15,16)/t4-,5-,6+/m0/s1 |
| InChIKey | YRVLXUKRIFZZRC-HCWXCVPCSA-N |
| XLogP | -1.52 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.22 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|