C5H13N2O4P — CID 131888538
[(1R)-1-[[(2S)-2-aminopropanoyl]amino]-1-deuterioethyl]phosphonic acid (PubChem CID 131888538) has the molecular formula C5H13N2O4P and a molecular weight of 197.15 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-2-aminopropanoyl]amino]-1-deuterioethyl]phosphonic acid.
| Compound Name | [(1R)-1-[[(2S)-2-aminopropanoyl]amino]-1-deuterioethyl]phosphonic acid |
|---|---|
| PubChem CID | 131888538 |
| Molecular Formula | C5H13N2O4P |
| Molecular Weight | 197.15 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | [(1R)-1-[[(2S)-2-aminopropanoyl]amino]-1-deuterioethyl]phosphonic acid |
| SMILES | [2H][C@@](C)(NC(=O)[C@H](C)N)P(=O)(O)O |
| InChI | InChI=1S/C5H13N2O4P/c1-3(6)5(8)7-4(2)12(9,10)11/h3-4H,6H2,1-2H3,(H,7,8)(H2,9,10,11)/t3-,4+/m0/s1/i4D |
| InChIKey | BHAYDBSYOBONRV-GWSSWEKMSA-N |
| XLogP | -1.03 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.15 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|