C10H21N2O4P — CID 15351769
[[[(2S)-2-aminopropanoyl]amino]-cyclohexylmethyl]phosphonic acid (PubChem CID 15351769) has the molecular formula C10H21N2O4P and a molecular weight of 264.26 g/mol. Its IUPAC name is [[[(2S)-2-aminopropanoyl]amino]-cyclohexylmethyl]phosphonic acid.
| Compound Name | [[[(2S)-2-aminopropanoyl]amino]-cyclohexylmethyl]phosphonic acid |
|---|---|
| PubChem CID | 15351769 |
| Molecular Formula | C10H21N2O4P |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | [[[(2S)-2-aminopropanoyl]amino]-cyclohexylmethyl]phosphonic acid |
| SMILES | C[C@H](N)C(=O)NC(C1CCCCC1)P(=O)(O)O |
| InChI | InChI=1S/C10H21N2O4P/c1-7(11)9(13)12-10(17(14,15)16)8-5-3-2-4-6-8/h7-8,10H,2-6,11H2,1H3,(H,12,13)(H2,14,15,16)/t7-,10?/m0/s1 |
| InChIKey | GUWXIIXSHWSNHY-BYDSUWOYSA-N |
| XLogP | 0.53 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|