C9H18NO4P — CID 10037048
[(1R)-1-cyclohexylethyl]carbamoylphosphonic acid (PubChem CID 10037048) has the molecular formula C9H18NO4P and a molecular weight of 235.22 g/mol. Its IUPAC name is [(1R)-1-cyclohexylethyl]carbamoylphosphonic acid.
| Compound Name | [(1R)-1-cyclohexylethyl]carbamoylphosphonic acid |
|---|---|
| PubChem CID | 10037048 |
| Molecular Formula | C9H18NO4P |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | [(1R)-1-cyclohexylethyl]carbamoylphosphonic acid |
| SMILES | C[C@@H](NC(=O)P(=O)(O)O)C1CCCCC1 |
| InChI | InChI=1S/C9H18NO4P/c1-7(8-5-3-2-4-6-8)10-9(11)15(12,13)14/h7-8H,2-6H2,1H3,(H,10,11)(H2,12,13,14)/t7-/m1/s1 |
| InChIKey | DFBCBGRDZHMYBK-SSDOTTSWSA-N |
| XLogP | 1.84 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|