C5H13N2O3P — CID 22811599
1-[[(2R)-2-aminopropanoyl]amino]ethylphosphonous acid (PubChem CID 22811599) has the molecular formula C5H13N2O3P and a molecular weight of 180.14 g/mol. Its IUPAC name is 1-[[(2R)-2-aminopropanoyl]amino]ethylphosphonous acid.
| Compound Name | 1-[[(2R)-2-aminopropanoyl]amino]ethylphosphonous acid |
|---|---|
| PubChem CID | 22811599 |
| Molecular Formula | C5H13N2O3P |
| Molecular Weight | 180.14 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 1-[[(2R)-2-aminopropanoyl]amino]ethylphosphonous acid |
| SMILES | CC(NC(=O)[C@@H](C)N)P(O)O |
| InChI | InChI=1S/C5H13N2O3P/c1-3(6)5(8)7-4(2)11(9)10/h3-4,9-10H,6H2,1-2H3,(H,7,8)/t3-,4?/m1/s1 |
| InChIKey | WPWZOWOBVRZORA-SYPWQXSBSA-N |
| XLogP | -0.91 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.14 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|