C9H17Cl2N2O5P — CID 158241330
[(1R)-1-[[(2R,5R)-5-amino-6-chloro-2-(chloromethyl)-4-oxohexanoyl]amino]ethyl]phosphonic acid (PubChem CID 158241330) has the molecular formula C9H17Cl2N2O5P and a molecular weight of 335.12 g/mol. Its IUPAC name is [(1R)-1-[[(2R,5R)-5-amino-6-chloro-2-(chloromethyl)-4-oxohexanoyl]amino]ethyl]phosphonic acid.
| Compound Name | [(1R)-1-[[(2R,5R)-5-amino-6-chloro-2-(chloromethyl)-4-oxohexanoyl]amino]ethyl]phosphonic acid |
|---|---|
| PubChem CID | 158241330 |
| Molecular Formula | C9H17Cl2N2O5P |
| Molecular Weight | 335.12 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | [(1R)-1-[[(2R,5R)-5-amino-6-chloro-2-(chloromethyl)-4-oxohexanoyl]amino]ethyl]phosphonic acid |
| SMILES | C[C@H](NC(=O)[C@H](CCl)CC(=O)[C@@H](N)CCl)P(=O)(O)O |
| InChI | InChI=1S/C9H17Cl2N2O5P/c1-5(19(16,17)18)13-9(15)6(3-10)2-8(14)7(12)4-11/h5-7H,2-4,12H2,1H3,(H,13,15)(H2,16,17,18)/t5-,6+,7+/m1/s1 |
| InChIKey | GFOOPOWOLGDXDO-VQVTYTSYSA-N |
| XLogP | 0.01 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.12 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|