C13H31ClN3O6P — CID 144923636
1-[[(2R)-2-(2-aminopentanoylamino)-3-chloropropanoyl]amino]ethylphosphonic acid;ethane;methanol (PubChem CID 144923636) has the molecular formula C13H31ClN3O6P and a molecular weight of 391.83 g/mol. Its IUPAC name is 1-[[(2R)-2-(2-aminopentanoylamino)-3-chloropropanoyl]amino]ethylphosphonic acid;ethane;methanol.
| Compound Name | 1-[[(2R)-2-(2-aminopentanoylamino)-3-chloropropanoyl]amino]ethylphosphonic acid;ethane;methanol |
|---|---|
| PubChem CID | 144923636 |
| Molecular Formula | C13H31ClN3O6P |
| Molecular Weight | 391.83 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 1-[[(2R)-2-(2-aminopentanoylamino)-3-chloropropanoyl]amino]ethylphosphonic acid;ethane;methanol |
| SMILES | CC.CCCC(N)C(=O)N[C@@H](CCl)C(=O)NC(C)P(=O)(O)O.CO |
| InChI | InChI=1S/C10H21ClN3O5P.C2H6.CH4O/c1-3-4-7(12)9(15)14-8(5-11)10(16)13-6(2)20(17,18)19;2*1-2/h6-8H,3-5,12H2,1-2H3,(H,13,16)(H,14,15)(H2,17,18,19);1-2H3;2H,1H3/t6?,7?,8-;;/m0../s1 |
| InChIKey | GZJABDWVWAGHIT-QBCDXEMOSA-N |
| XLogP | 0.11 |
| TPSA | 161.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.83 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|