C7H15N2O6P — CID 21307978
(3S)-4-amino-4-oxo-3-(2-phosphonopropylamino)butanoic acid (PubChem CID 21307978) has the molecular formula C7H15N2O6P and a molecular weight of 254.18 g/mol. Its IUPAC name is (3S)-4-amino-4-oxo-3-(2-phosphonopropylamino)butanoic acid.
| Compound Name | (3S)-4-amino-4-oxo-3-(2-phosphonopropylamino)butanoic acid |
|---|---|
| PubChem CID | 21307978 |
| Molecular Formula | C7H15N2O6P |
| Molecular Weight | 254.18 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | (3S)-4-amino-4-oxo-3-(2-phosphonopropylamino)butanoic acid |
| SMILES | CC(CN[C@@H](CC(=O)O)C(N)=O)P(=O)(O)O |
| InChI | InChI=1S/C7H15N2O6P/c1-4(16(13,14)15)3-9-5(7(8)12)2-6(10)11/h4-5,9H,2-3H2,1H3,(H2,8,12)(H,10,11)(H2,13,14,15)/t4?,5-/m0/s1 |
| InChIKey | NQMUMHUOKKZZHF-AKGZTFGVSA-N |
| XLogP | -1.53 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.18 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|