C11H22NO5+ — CID 87443548
(1,2-dicarboxy-4-hydroxy-2-methylpentyl)-trimethylazanium (PubChem CID 87443548) has the molecular formula C11H22NO5+ and a molecular weight of 248.30 g/mol. Its IUPAC name is (1,2-dicarboxy-4-hydroxy-2-methylpentyl)-trimethylazanium.
| Compound Name | (1,2-dicarboxy-4-hydroxy-2-methylpentyl)-trimethylazanium |
|---|---|
| PubChem CID | 87443548 |
| Molecular Formula | C11H22NO5+ |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | (1,2-dicarboxy-4-hydroxy-2-methylpentyl)-trimethylazanium |
| SMILES | CC(O)CC(C)(C(=O)O)C(C(=O)O)[N+](C)(C)C |
| InChI | InChI=1S/C11H21NO5/c1-7(13)6-11(2,10(16)17)8(9(14)15)12(3,4)5/h7-8,13H,6H2,1-5H3,(H-,14,15,16,17)/p+1 |
| InChIKey | KMRSXZRQUCWPDO-UHFFFAOYSA-O |
| XLogP | 0.01 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|