3,3-dihydroxy-2-(hydroxymethyl)-2-methylpropanoic acid

C5H10O5 — CID 141219993

IUPAC3,3-dihydroxy-2-(hydroxymethyl)-2-methylpropanoic acid
SMILESCC(CO)(C(=O)O)C(O)O
InChIInChI=1S/C5H10O5/c1-5(2-6,3(7)8)4(9)10/h3,6-8H,2H2,1H3,(H,9,10)
InChIKeyATEQRAVSAINHBS-UHFFFAOYSA-N
MW150.13 g/mol
LogP-1.62
Rot. Bonds3

About 3,3-dihydroxy-2-(hydroxymethyl)-2-methylpropanoic acid

3,3-dihydroxy-2-(hydroxymethyl)-2-methylpropanoic acid (PubChem CID 141219993) has the molecular formula C5H10O5 and a molecular weight of 150.13 g/mol. Its IUPAC name is 3,3-dihydroxy-2-(hydroxymethyl)-2-methylpropanoic acid.

Molecular Properties

Compound Name3,3-dihydroxy-2-(hydroxymethyl)-2-methylpropanoic acid
PubChem CID141219993
Molecular FormulaC5H10O5
Molecular Weight150.13 g/mol
Exact Mass150.05
IUPAC Name3,3-dihydroxy-2-(hydroxymethyl)-2-methylpropanoic acid
SMILESCC(CO)(C(=O)O)C(O)O
InChIInChI=1S/C5H10O5/c1-5(2-6,3(7)8)4(9)10/h3,6-8H,2H2,1H3,(H,9,10)
InChIKeyATEQRAVSAINHBS-UHFFFAOYSA-N
XLogP-1.62
TPSA97.99 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500150.13
LogP ≤ 5-1.62
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 3,3-dihydroxy-2-(hydroxymethyl)-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,3-dihydroxy-2-(hydroxymethyl)-2-methylpropanoic acid?
The IUPAC name of 3,3-dihydroxy-2-(hydroxymethyl)-2-methylpropanoic acid (CID 141219993) is 3,3-dihydroxy-2-(hydroxymethyl)-2-methylpropanoic acid.
What is the SMILES notation for 3,3-dihydroxy-2-(hydroxymethyl)-2-methylpropanoic acid?
The canonical SMILES for 3,3-dihydroxy-2-(hydroxymethyl)-2-methylpropanoic acid is CC(CO)(C(=O)O)C(O)O.
What is the InChIKey of 3,3-dihydroxy-2-(hydroxymethyl)-2-methylpropanoic acid?
The InChIKey is ATEQRAVSAINHBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O5/c1-5(2-6,3(7)8)4(9)10/h3,6-8H,2H2,1H3,(H,9,10).
What are the key properties of 3,3-dihydroxy-2-(hydroxymethyl)-2-methylpropanoic acid?
3,3-dihydroxy-2-(hydroxymethyl)-2-methylpropanoic acid has a molecular weight of 150.13 g/mol, XLogP of -1.62, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dihydroxy-2-(hydroxymethyl)-2-methylpropanoic acid is sourced from PubChem (CID 141219993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).