C6H12NaO4 — CID 131881947
CID 131881947 (PubChem CID 131881947) has the molecular formula C6H12NaO4 and a molecular weight of 171.15 g/mol.
| Compound Name | CID 131881947 |
|---|---|
| PubChem CID | 131881947 |
| Molecular Formula | C6H12NaO4 |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | — |
| SMILES | CC(C)(CO)[C@@H](O)C(=O)O.[Na] |
| InChI | InChI=1S/C6H12O4.Na/c1-6(2,3-7)4(8)5(9)10;/h4,7-8H,3H2,1-2H3,(H,9,10);/t4-;/m0./s1 |
| InChIKey | DWNWJMBEOMMQLC-WCCKRBBISA-N |
| XLogP | -0.93 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |