About CID 131881947
CID 131881947 (PubChem CID 131881947) has the molecular formula C6H12NaO4
and a molecular weight of 171.15 g/mol.
Molecular Properties
| Compound Name | CID 131881947 |
| PubChem CID | 131881947 |
| Molecular Formula | C6H12NaO4 |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | — |
| SMILES | CC(C)(CO)[C@@H](O)C(=O)O.[Na] |
| InChI | InChI=1S/C6H12O4.Na/c1-6(2,3-7)4(8)5(9)10;/h4,7-8H,3H2,1-2H3,(H,9,10);/t4-;/m0./s1 |
| InChIKey | DWNWJMBEOMMQLC-WCCKRBBISA-N |
| XLogP | -0.93 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 131881947 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131881947?
The IUPAC name of CID 131881947 (CID 131881947) is not available.
What is the SMILES notation for CID 131881947?
The canonical SMILES for CID 131881947 is CC(C)(CO)[C@@H](O)C(=O)O.[Na].
What is the InChIKey of CID 131881947?
The InChIKey is DWNWJMBEOMMQLC-WCCKRBBISA-N. The full InChI is InChI=1S/C6H12O4.Na/c1-6(2,3-7)4(8)5(9)10;/h4,7-8H,3H2,1-2H3,(H,9,10);/t4-;/m0./s1.
What are the key properties of CID 131881947?
CID 131881947 has a molecular weight of 171.15 g/mol, XLogP of -0.93, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131881947 is sourced from PubChem (CID 131881947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).