C6H12O4S — CID 90202145
(2R)-2-hydroxy-3,3-dimethyl-4-sulfanyloxybutanoic acid (PubChem CID 90202145) has the molecular formula C6H12O4S and a molecular weight of 180.22 g/mol. Its IUPAC name is (2R)-2-hydroxy-3,3-dimethyl-4-sulfanyloxybutanoic acid.
| Compound Name | (2R)-2-hydroxy-3,3-dimethyl-4-sulfanyloxybutanoic acid |
|---|---|
| PubChem CID | 90202145 |
| Molecular Formula | C6H12O4S |
| Molecular Weight | 180.22 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | (2R)-2-hydroxy-3,3-dimethyl-4-sulfanyloxybutanoic acid |
| SMILES | CC(C)(COS)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C6H12O4S/c1-6(2,3-10-11)4(7)5(8)9/h4,7,11H,3H2,1-2H3,(H,8,9)/t4-/m0/s1 |
| InChIKey | KEGYGLFVSVBEFG-BYPYZUCNSA-N |
| XLogP | 0.32 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.22 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|