4-amino-3,3-dimethyl-2-sulfanylbutanoic acid

C6H13NO2S — CID 154153268

IUPAC4-amino-3,3-dimethyl-2-sulfanylbutanoic acid
SMILESCC(C)(CN)C(S)C(=O)O
InChIInChI=1S/C6H13NO2S/c1-6(2,3-7)4(10)5(8)9/h4,10H,3,7H2,1-2H3,(H,8,9)
InChIKeyPNYFPJWWYKCIGX-UHFFFAOYSA-N
MW163.24 g/mol
LogP0.35
Rot. Bonds3

About 4-amino-3,3-dimethyl-2-sulfanylbutanoic acid

4-amino-3,3-dimethyl-2-sulfanylbutanoic acid (PubChem CID 154153268) has the molecular formula C6H13NO2S and a molecular weight of 163.24 g/mol. Its IUPAC name is 4-amino-3,3-dimethyl-2-sulfanylbutanoic acid.

Molecular Properties

Compound Name4-amino-3,3-dimethyl-2-sulfanylbutanoic acid
PubChem CID154153268
Molecular FormulaC6H13NO2S
Molecular Weight163.24 g/mol
Exact Mass163.07
IUPAC Name4-amino-3,3-dimethyl-2-sulfanylbutanoic acid
SMILESCC(C)(CN)C(S)C(=O)O
InChIInChI=1S/C6H13NO2S/c1-6(2,3-7)4(10)5(8)9/h4,10H,3,7H2,1-2H3,(H,8,9)
InChIKeyPNYFPJWWYKCIGX-UHFFFAOYSA-N
XLogP0.35
TPSA63.32 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500163.24
LogP ≤ 50.35
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze 4-amino-3,3-dimethyl-2-sulfanylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-amino-3,3-dimethyl-2-sulfanylbutanoic acid?
The IUPAC name of 4-amino-3,3-dimethyl-2-sulfanylbutanoic acid (CID 154153268) is 4-amino-3,3-dimethyl-2-sulfanylbutanoic acid.
What is the SMILES notation for 4-amino-3,3-dimethyl-2-sulfanylbutanoic acid?
The canonical SMILES for 4-amino-3,3-dimethyl-2-sulfanylbutanoic acid is CC(C)(CN)C(S)C(=O)O.
What is the InChIKey of 4-amino-3,3-dimethyl-2-sulfanylbutanoic acid?
The InChIKey is PNYFPJWWYKCIGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2S/c1-6(2,3-7)4(10)5(8)9/h4,10H,3,7H2,1-2H3,(H,8,9).
What are the key properties of 4-amino-3,3-dimethyl-2-sulfanylbutanoic acid?
4-amino-3,3-dimethyl-2-sulfanylbutanoic acid has a molecular weight of 163.24 g/mol, XLogP of 0.35, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3,3-dimethyl-2-sulfanylbutanoic acid is sourced from PubChem (CID 154153268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).