C7H17N3O4 — CID 88797695
(2R)-2,4-dihydroxy-3,3-dimethylbutanoic acid;guanidine (PubChem CID 88797695) has the molecular formula C7H17N3O4 and a molecular weight of 207.23 g/mol. Its IUPAC name is (2R)-2,4-dihydroxy-3,3-dimethylbutanoic acid;guanidine.
| Compound Name | (2R)-2,4-dihydroxy-3,3-dimethylbutanoic acid;guanidine |
|---|---|
| PubChem CID | 88797695 |
| Molecular Formula | C7H17N3O4 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | (2R)-2,4-dihydroxy-3,3-dimethylbutanoic acid;guanidine |
| SMILES | CC(C)(CO)[C@@H](O)C(=O)O.[H]N=C(N)N |
| InChI | InChI=1S/C6H12O4.CH5N3/c1-6(2,3-7)4(8)5(9)10;2-1(3)4/h4,7-8H,3H2,1-2H3,(H,9,10);(H5,2,3,4)/t4-;/m0./s1 |
| InChIKey | PCIDHEHSKLXGNB-WCCKRBBISA-N |
| XLogP | -1.71 |
| TPSA | 153.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|