C6H14N2O3 — CID 818715
(2R)-2,4-dihydroxy-3,3-dimethylbutanehydrazide (PubChem CID 818715) has the molecular formula C6H14N2O3 and a molecular weight of 162.19 g/mol. Its IUPAC name is (2R)-2,4-dihydroxy-3,3-dimethylbutanehydrazide.
| Compound Name | (2R)-2,4-dihydroxy-3,3-dimethylbutanehydrazide |
|---|---|
| PubChem CID | 818715 |
| Molecular Formula | C6H14N2O3 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | (2R)-2,4-dihydroxy-3,3-dimethylbutanehydrazide |
| SMILES | CC(C)(CO)[C@@H](O)C(=O)NN |
| InChI | InChI=1S/C6H14N2O3/c1-6(2,3-9)4(10)5(11)8-7/h4,9-10H,3,7H2,1-2H3,(H,8,11)/t4-/m0/s1 |
| InChIKey | GIEOPWBZNAVUBX-BYPYZUCNSA-N |
| XLogP | -1.64 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|