C10H22O4 — CID 162717045
2,2-dimethylpropane-1,1-diol;3-hydroxy-2,2-dimethylpropanal (PubChem CID 162717045) has the molecular formula C10H22O4 and a molecular weight of 206.28 g/mol. Its IUPAC name is 2,2-dimethylpropane-1,1-diol;3-hydroxy-2,2-dimethylpropanal.
| Compound Name | 2,2-dimethylpropane-1,1-diol;3-hydroxy-2,2-dimethylpropanal |
|---|---|
| PubChem CID | 162717045 |
| Molecular Formula | C10H22O4 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 2,2-dimethylpropane-1,1-diol;3-hydroxy-2,2-dimethylpropanal |
| SMILES | CC(C)(C)C(O)O.CC(C)(C=O)CO |
| InChI | InChI=1S/C5H12O2.C5H10O2/c1-5(2,3)4(6)7;1-5(2,3-6)4-7/h4,6-7H,1-3H3;3,7H,4H2,1-2H3 |
| InChIKey | CDFBVHXAZXGXKQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|