C7H12O7 — CID 141125604
(2S,4R)-2,3,4-trihydroxy-2,4-bis(hydroxymethyl)pentanedial (PubChem CID 141125604) has the molecular formula C7H12O7 and a molecular weight of 208.17 g/mol. Its IUPAC name is (2S,4R)-2,3,4-trihydroxy-2,4-bis(hydroxymethyl)pentanedial.
| Compound Name | (2S,4R)-2,3,4-trihydroxy-2,4-bis(hydroxymethyl)pentanedial |
|---|---|
| PubChem CID | 141125604 |
| Molecular Formula | C7H12O7 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | (2S,4R)-2,3,4-trihydroxy-2,4-bis(hydroxymethyl)pentanedial |
| SMILES | O=C[C@@](O)(CO)C(O)[C@](O)(C=O)CO |
| InChI | InChI=1S/C7H12O7/c8-1-6(13,2-9)5(12)7(14,3-10)4-11/h1,3,5,9,11-14H,2,4H2/t5?,6-,7+ |
| InChIKey | ZJWQYIYJIBYNRC-DGUCWDHESA-N |
| XLogP | -3.81 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | -3.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|