C8H16O8 — CID 174913015
2,3,4,5,6-pentahydroxy-2,4-dimethoxyhexanal (PubChem CID 174913015) has the molecular formula C8H16O8 and a molecular weight of 240.21 g/mol. Its IUPAC name is 2,3,4,5,6-pentahydroxy-2,4-dimethoxyhexanal.
| Compound Name | 2,3,4,5,6-pentahydroxy-2,4-dimethoxyhexanal |
|---|---|
| PubChem CID | 174913015 |
| Molecular Formula | C8H16O8 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 2,3,4,5,6-pentahydroxy-2,4-dimethoxyhexanal |
| SMILES | COC(O)(C=O)C(O)C(O)(OC)C(O)CO |
| InChI | InChI=1S/C8H16O8/c1-15-7(13,4-10)6(12)8(14,16-2)5(11)3-9/h4-6,9,11-14H,3H2,1-2H3 |
| InChIKey | GYNLOXPFUFSNOZ-UHFFFAOYSA-N |
| XLogP | -3.43 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|