C7H14O7 — CID 22868666
(2R,3S,4S)-2,3,4,5,6-pentahydroxy-5-(hydroxymethyl)hexanal (PubChem CID 22868666) has the molecular formula C7H14O7 and a molecular weight of 210.18 g/mol. Its IUPAC name is (2R,3S,4S)-2,3,4,5,6-pentahydroxy-5-(hydroxymethyl)hexanal.
| Compound Name | (2R,3S,4S)-2,3,4,5,6-pentahydroxy-5-(hydroxymethyl)hexanal |
|---|---|
| PubChem CID | 22868666 |
| Molecular Formula | C7H14O7 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | (2R,3S,4S)-2,3,4,5,6-pentahydroxy-5-(hydroxymethyl)hexanal |
| SMILES | O=C[C@H](O)[C@@H](O)[C@H](O)C(O)(CO)CO |
| InChI | InChI=1S/C7H14O7/c8-1-4(11)5(12)6(13)7(14,2-9)3-10/h1,4-6,9-14H,2-3H2/t4-,5+,6-/m0/s1 |
| InChIKey | XZYUBZMKCHVMJS-JKUQZMGJSA-N |
| XLogP | -4.02 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | -4.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|