C7H11NO5 — CID 87203126
(2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-2-methyl-6-oxohexanenitrile (PubChem CID 87203126) has the molecular formula C7H11NO5 and a molecular weight of 189.17 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-2-methyl-6-oxohexanenitrile.
| Compound Name | (2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-2-methyl-6-oxohexanenitrile |
|---|---|
| PubChem CID | 87203126 |
| Molecular Formula | C7H11NO5 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | (2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-2-methyl-6-oxohexanenitrile |
| SMILES | C[C@](O)(C#N)[C@H](O)[C@H](O)[C@@H](O)C=O |
| InChI | InChI=1S/C7H11NO5/c1-7(13,3-8)6(12)5(11)4(10)2-9/h2,4-6,10-13H,1H3/t4-,5+,6+,7-/m0/s1 |
| InChIKey | SILHPFXNOUTDSM-WNJXEPBRSA-N |
| XLogP | -2.46 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|