C7H9NO6 — CID 139785635
(2S,3S,4S,5R)-3-cyano-2,4,5-trihydroxy-6-oxohexanoic acid (PubChem CID 139785635) has the molecular formula C7H9NO6 and a molecular weight of 203.15 g/mol. Its IUPAC name is (2S,3S,4S,5R)-3-cyano-2,4,5-trihydroxy-6-oxohexanoic acid.
| Compound Name | (2S,3S,4S,5R)-3-cyano-2,4,5-trihydroxy-6-oxohexanoic acid |
|---|---|
| PubChem CID | 139785635 |
| Molecular Formula | C7H9NO6 |
| Molecular Weight | 203.15 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | (2S,3S,4S,5R)-3-cyano-2,4,5-trihydroxy-6-oxohexanoic acid |
| SMILES | N#C[C@@H]([C@H](O)[C@@H](O)C=O)[C@H](O)C(=O)O |
| InChI | InChI=1S/C7H9NO6/c8-1-3(6(12)7(13)14)5(11)4(10)2-9/h2-6,10-12H,(H,13,14)/t3-,4-,5-,6-/m0/s1 |
| InChIKey | ZLEDSYIYYXUFDF-BXKVDMCESA-N |
| XLogP | -2.51 |
| TPSA | 138.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.15 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|