C6H9O7- — CID 14123183
2,3,4,5-tetrahydroxy-6-oxohexanoate (PubChem CID 14123183) has the molecular formula C6H9O7- and a molecular weight of 193.13 g/mol. Its IUPAC name is 2,3,4,5-tetrahydroxy-6-oxohexanoate.
| Compound Name | 2,3,4,5-tetrahydroxy-6-oxohexanoate |
|---|---|
| PubChem CID | 14123183 |
| Molecular Formula | C6H9O7- |
| Molecular Weight | 193.13 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | 2,3,4,5-tetrahydroxy-6-oxohexanoate |
| SMILES | O=CC(O)C(O)C(O)C(O)C(=O)[O-] |
| InChI | InChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h1-5,8-11H,(H,12,13)/p-1 |
| InChIKey | IAJILQKETJEXLJ-UHFFFAOYSA-M |
| XLogP | -4.62 |
| TPSA | 138.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.13 |
| LogP ≤ 5 | -4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|