C6H9O11S-3 — CID 21145043
(2R,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate sulfate (PubChem CID 21145043) has the molecular formula C6H9O11S-3 and a molecular weight of 289.19 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate sulfate.
| Compound Name | (2R,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate sulfate |
|---|---|
| PubChem CID | 21145043 |
| Molecular Formula | C6H9O11S-3 |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | (2R,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate sulfate |
| SMILES | O=C[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)[O-].O=S(=O)([O-])[O-] |
| InChI | InChI=1S/C6H10O7.H2O4S/c7-1-2(8)3(9)4(10)5(11)6(12)13;1-5(2,3)4/h1-5,8-11H,(H,12,13);(H2,1,2,3,4)/p-3/t2-,3+,4-,5+;/m0./s1 |
| InChIKey | MGXQNMLHMKAXJR-XVWKMKMJSA-K |
| XLogP | -5.96 |
| TPSA | 218.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | -5.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|