C12H25NO7 — CID 155587187
(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate;triethylazanium (PubChem CID 155587187) has the molecular formula C12H25NO7 and a molecular weight of 295.33 g/mol. Its IUPAC name is (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate;triethylazanium.
| Compound Name | (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate;triethylazanium |
|---|---|
| PubChem CID | 155587187 |
| Molecular Formula | C12H25NO7 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate;triethylazanium |
| SMILES | CC[NH+](CC)CC.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(=O)[O-] |
| InChI | InChI=1S/C6H15N.C6H10O7/c1-4-7(5-2)6-3;7-1-2(8)3(9)4(10)5(11)6(12)13/h4-6H2,1-3H3;1-5,8-11H,(H,12,13)/t;2-,3+,4-,5-/m.0/s1 |
| InChIKey | KYBGPKVLYCBGRF-LRDBBFHQSA-N |
| XLogP | -4.69 |
| TPSA | 142.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | -4.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|