C6H9O11P-4 — CID 21145067
(2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate phosphate (PubChem CID 21145067) has the molecular formula C6H9O11P-4 and a molecular weight of 288.10 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate phosphate.
| Compound Name | (2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate phosphate |
|---|---|
| PubChem CID | 21145067 |
| Molecular Formula | C6H9O11P-4 |
| Molecular Weight | 288.10 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | (2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate phosphate |
| SMILES | O=C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(=O)[O-].O=P([O-])([O-])[O-] |
| InChI | InChI=1S/C6H10O7.H3O4P/c7-1-2(8)3(9)4(10)5(11)6(12)13;1-5(2,3)4/h1-5,8-11H,(H,12,13);(H3,1,2,3,4)/p-4/t2-,3+,4+,5-;/m0./s1 |
| InChIKey | DBJXZAHVTMPKQP-RMTXHFLUSA-J |
| XLogP | -7.45 |
| TPSA | 224.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.10 |
| LogP ≤ 5 | -7.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|