C11H21NO9 — CID 118856438
carboxymethyl(trimethyl)azanium;(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate (PubChem CID 118856438) has the molecular formula C11H21NO9 and a molecular weight of 311.29 g/mol. Its IUPAC name is carboxymethyl(trimethyl)azanium;(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate.
| Compound Name | carboxymethyl(trimethyl)azanium;(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate |
|---|---|
| PubChem CID | 118856438 |
| Molecular Formula | C11H21NO9 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | carboxymethyl(trimethyl)azanium;(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate |
| SMILES | C[N+](C)(C)CC(=O)O.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(=O)[O-] |
| InChI | InChI=1S/C6H10O7.C5H11NO2/c7-1-2(8)3(9)4(10)5(11)6(12)13;1-6(2,3)4-5(7)8/h1-5,8-11H,(H,12,13);4H2,1-3H3/t2-,3+,4-,5-;/m0./s1 |
| InChIKey | NTRGSJJAAMSXHU-JSCKKFHOSA-N |
| XLogP | -4.84 |
| TPSA | 175.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | -4.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|