C8H16O7 — CID 161182405
ethane;(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid (PubChem CID 161182405) has the molecular formula C8H16O7 and a molecular weight of 224.21 g/mol. Its IUPAC name is ethane;(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid.
| Compound Name | ethane;(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
|---|---|
| PubChem CID | 161182405 |
| Molecular Formula | C8H16O7 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | ethane;(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
| SMILES | CC.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(=O)O |
| InChI | InChI=1S/C6H10O7.C2H6/c7-1-2(8)3(9)4(10)5(11)6(12)13;1-2/h1-5,8-11H,(H,12,13);1-2H3/t2-,3+,4-,5-;/m0./s1 |
| InChIKey | USQHEXFXLZMIBB-JSCKKFHOSA-N |
| XLogP | -2.26 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|