C18H26O21 — CID 87194699
(2R,3S,4S,5S)-2-[(2R,3S,4R,5S)-5-carboxy-2,3,4,5-tetrahydroxypentanoyl]oxy-4,5-dihydroxy-3-[(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoyl]oxyhexanedioic acid (PubChem CID 87194699) has the molecular formula C18H26O21 and a molecular weight of 578.39 g/mol. Its IUPAC name is (2R,3S,4S,5S)-2-[(2R,3S,4R,5S)-5-carboxy-2,3,4,5-tetrahydroxypentanoyl]oxy-4,5-dihydroxy-3-[(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoyl]oxyhexanedioic acid.
| Compound Name | (2R,3S,4S,5S)-2-[(2R,3S,4R,5S)-5-carboxy-2,3,4,5-tetrahydroxypentanoyl]oxy-4,5-dihydroxy-3-[(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoyl]oxyhexanedioic acid |
|---|---|
| PubChem CID | 87194699 |
| Molecular Formula | C18H26O21 |
| Molecular Weight | 578.39 g/mol |
| Exact Mass | 578.10 |
| IUPAC Name | (2R,3S,4S,5S)-2-[(2R,3S,4R,5S)-5-carboxy-2,3,4,5-tetrahydroxypentanoyl]oxy-4,5-dihydroxy-3-[(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoyl]oxyhexanedioic acid |
| SMILES | O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(=O)O[C@@H]([C@@H](O)[C@H](O)C(=O)O)[C@@H](OC(=O)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C18H26O21/c19-1-2(20)3(21)4(22)10(28)17(36)38-12(7(25)9(27)15(32)33)13(16(34)35)39-18(37)11(29)6(24)5(23)8(26)14(30)31/h1-13,20-29H,(H,30,31)(H,32,33)(H,34,35)/t2-,3+,4-,5+,6-,7-,8-,9-,10-,11+,12-,13+/m0/s1 |
| InChIKey | ZAXCDVAUJRDPMB-XJQWNMQUSA-N |
| XLogP | -9.13 |
| TPSA | 383.87 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.39 |
| LogP ≤ 5 | -9.13 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|